C11H21NO2S — CID 79946339
5,5-dimethyl-3-(propan-2-ylamino)thiane-3-carboxylic acid (PubChem CID 79946339) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is 5,5-dimethyl-3-(propan-2-ylamino)thiane-3-carboxylic acid.
| Compound Name | 5,5-dimethyl-3-(propan-2-ylamino)thiane-3-carboxylic acid |
|---|---|
| PubChem CID | 79946339 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 5,5-dimethyl-3-(propan-2-ylamino)thiane-3-carboxylic acid |
| SMILES | CC(C)NC1(C(=O)O)CSCC(C)(C)C1 |
| InChI | InChI=1S/C11H21NO2S/c1-8(2)12-11(9(13)14)5-10(3,4)6-15-7-11/h8,12H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | BGHPZQIUKPAPEV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |