C12H21NO2S — CID 79946555
5,5-dimethyl-3-pyrrolidin-1-ylthiane-3-carboxylic acid (PubChem CID 79946555) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is 5,5-dimethyl-3-pyrrolidin-1-ylthiane-3-carboxylic acid.
| Compound Name | 5,5-dimethyl-3-pyrrolidin-1-ylthiane-3-carboxylic acid |
|---|---|
| PubChem CID | 79946555 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 5,5-dimethyl-3-pyrrolidin-1-ylthiane-3-carboxylic acid |
| SMILES | CC1(C)CSCC(C(=O)O)(N2CCCC2)C1 |
| InChI | InChI=1S/C12H21NO2S/c1-11(2)7-12(10(14)15,9-16-8-11)13-5-3-4-6-13/h3-9H2,1-2H3,(H,14,15) |
| InChIKey | SYVZCJFDZPSNEE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |