C11H21NO2S — CID 79947492
2-[(5,5-dimethylthian-3-yl)-ethylamino]acetic acid (PubChem CID 79947492) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is 2-[(5,5-dimethylthian-3-yl)-ethylamino]acetic acid.
| Compound Name | 2-[(5,5-dimethylthian-3-yl)-ethylamino]acetic acid |
|---|---|
| PubChem CID | 79947492 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-[(5,5-dimethylthian-3-yl)-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CSCC(C)(C)C1 |
| InChI | InChI=1S/C11H21NO2S/c1-4-12(6-10(13)14)9-5-11(2,3)8-15-7-9/h9H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | ZLLUKBZDSWEYMR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |