C12H21N3S — CID 79948121
N-[2-(1H-imidazol-5-yl)ethyl]-4,4-dimethylthian-3-amine (PubChem CID 79948121) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-4,4-dimethylthian-3-amine.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]-4,4-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79948121 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-4,4-dimethylthian-3-amine |
| SMILES | CC1(C)CCSCC1NCCc1cnc[nH]1 |
| InChI | InChI=1S/C12H21N3S/c1-12(2)4-6-16-8-11(12)14-5-3-10-7-13-9-15-10/h7,9,11,14H,3-6,8H2,1-2H3,(H,13,15) |
| InChIKey | JOGVDHDHYVQQTN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |