C12H19N3 — CID 65232015
N-[2-(1H-imidazol-5-yl)ethyl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 65232015) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 65232015 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | c1ncc(CCNC2CC3CCC2C3)[nH]1 |
| InChI | InChI=1S/C12H19N3/c1-2-10-5-9(1)6-12(10)14-4-3-11-7-13-8-15-11/h7-10,12,14H,1-6H2,(H,13,15) |
| InChIKey | MYEJSUMEZZXEQY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |