C16H30N2S — CID 79949011
1-(4,4-dimethylthian-3-yl)-2-pyrrolidin-2-ylpiperidine (PubChem CID 79949011) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 1-(4,4-dimethylthian-3-yl)-2-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-(4,4-dimethylthian-3-yl)-2-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 79949011 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-(4,4-dimethylthian-3-yl)-2-pyrrolidin-2-ylpiperidine |
| SMILES | CC1(C)CCSCC1N1CCCCC1C1CCCN1 |
| InChI | InChI=1S/C16H30N2S/c1-16(2)8-11-19-12-15(16)18-10-4-3-7-14(18)13-6-5-9-17-13/h13-15,17H,3-12H2,1-2H3 |
| InChIKey | YWYPIIUFWIHWFX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |