C15H20N4S — CID 79949022
N-(4,4-dimethylthian-3-yl)-6-imidazol-1-ylpyridin-3-amine (PubChem CID 79949022) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is N-(4,4-dimethylthian-3-yl)-6-imidazol-1-ylpyridin-3-amine.
| Compound Name | N-(4,4-dimethylthian-3-yl)-6-imidazol-1-ylpyridin-3-amine |
|---|---|
| PubChem CID | 79949022 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-(4,4-dimethylthian-3-yl)-6-imidazol-1-ylpyridin-3-amine |
| SMILES | CC1(C)CCSCC1Nc1ccc(-n2ccnc2)nc1 |
| InChI | InChI=1S/C15H20N4S/c1-15(2)5-8-20-10-13(15)18-12-3-4-14(17-9-12)19-7-6-16-11-19/h3-4,6-7,9,11,13,18H,5,8,10H2,1-2H3 |
| InChIKey | GMSOXDHXCQBNIW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |