About 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol
3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol (PubChem CID 79949446) has the molecular formula C12H15NOS
and a molecular weight of 221.32 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol |
| PubChem CID | 79949446 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol |
| SMILES | OC1(C2Cc3ccccc3N2)CCSC1 |
| InChI | InChI=1S/C12H15NOS/c14-12(5-6-15-8-12)11-7-9-3-1-2-4-10(9)13-11/h1-4,11,13-14H,5-8H2 |
| InChIKey | FEJOUKAFIPBTLY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol?
The IUPAC name of 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol (CID 79949446) is 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol.
What is the SMILES notation for 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol?
The canonical SMILES for 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol is OC1(C2Cc3ccccc3N2)CCSC1.
What is the InChIKey of 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol?
The InChIKey is FEJOUKAFIPBTLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NOS/c14-12(5-6-15-8-12)11-7-9-3-1-2-4-10(9)13-11/h1-4,11,13-14H,5-8H2.
What are the key properties of 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol?
3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol has a molecular weight of 221.32 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol is sourced from PubChem (CID 79949446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).