C12H15NOS — CID 79949446
3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol (PubChem CID 79949446) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol.
| Compound Name | 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol |
|---|---|
| PubChem CID | 79949446 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-2-yl)thiolan-3-ol |
| SMILES | OC1(C2Cc3ccccc3N2)CCSC1 |
| InChI | InChI=1S/C12H15NOS/c14-12(5-6-15-8-12)11-7-9-3-1-2-4-10(9)13-11/h1-4,11,13-14H,5-8H2 |
| InChIKey | FEJOUKAFIPBTLY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |