C14H20N2O — CID 80561154
3-amino-1-(2,3-dihydro-1H-indol-2-yl)cyclohexan-1-ol (PubChem CID 80561154) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-amino-1-(2,3-dihydro-1H-indol-2-yl)cyclohexan-1-ol.
| Compound Name | 3-amino-1-(2,3-dihydro-1H-indol-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 80561154 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-amino-1-(2,3-dihydro-1H-indol-2-yl)cyclohexan-1-ol |
| SMILES | NC1CCCC(O)(C2Cc3ccccc3N2)C1 |
| InChI | InChI=1S/C14H20N2O/c15-11-5-3-7-14(17,9-11)13-8-10-4-1-2-6-12(10)16-13/h1-2,4,6,11,13,16-17H,3,5,7-9,15H2 |
| InChIKey | VHGDEAANLVWHGD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |