C14H22N2S2 — CID 79950337
3-(aminomethyl)-N-cyclopropyl-5-methyl-N-(thiophen-2-ylmethyl)thiolan-3-amine (PubChem CID 79950337) has the molecular formula C14H22N2S2 and a molecular weight of 282.48 g/mol. Its IUPAC name is 3-(aminomethyl)-N-cyclopropyl-5-methyl-N-(thiophen-2-ylmethyl)thiolan-3-amine.
| Compound Name | 3-(aminomethyl)-N-cyclopropyl-5-methyl-N-(thiophen-2-ylmethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 79950337 |
| Molecular Formula | C14H22N2S2 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-(aminomethyl)-N-cyclopropyl-5-methyl-N-(thiophen-2-ylmethyl)thiolan-3-amine |
| SMILES | CC1CC(CN)(N(Cc2cccs2)C2CC2)CS1 |
| InChI | InChI=1S/C14H22N2S2/c1-11-7-14(9-15,10-18-11)16(12-4-5-12)8-13-3-2-6-17-13/h2-3,6,11-12H,4-5,7-10,15H2,1H3 |
| InChIKey | WINNCVXRJFANCC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |