C10H20N2OS — CID 79951940
2-methyl-3-(propan-2-ylamino)thiane-3-carboxamide (PubChem CID 79951940) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is 2-methyl-3-(propan-2-ylamino)thiane-3-carboxamide.
| Compound Name | 2-methyl-3-(propan-2-ylamino)thiane-3-carboxamide |
|---|---|
| PubChem CID | 79951940 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-methyl-3-(propan-2-ylamino)thiane-3-carboxamide |
| SMILES | CC(C)NC1(C(N)=O)CCCSC1C |
| InChI | InChI=1S/C10H20N2OS/c1-7(2)12-10(9(11)13)5-4-6-14-8(10)3/h7-8,12H,4-6H2,1-3H3,(H2,11,13) |
| InChIKey | TUIGFANOCODYKC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |