C9H15F3N2OS — CID 79952142
2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide (PubChem CID 79952142) has the molecular formula C9H15F3N2OS and a molecular weight of 256.29 g/mol. Its IUPAC name is 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide.
| Compound Name | 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide |
|---|---|
| PubChem CID | 79952142 |
| Molecular Formula | C9H15F3N2OS |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide |
| SMILES | CC1SCCCC1(NCC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C9H15F3N2OS/c1-6-8(7(13)15,3-2-4-16-6)14-5-9(10,11)12/h6,14H,2-5H2,1H3,(H2,13,15) |
| InChIKey | KFQYPQJRSBHKHG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |