C12H17F3N2O — CID 79953419
1-(1-butan-2-ylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one (PubChem CID 79953419) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-(1-butan-2-ylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one.
| Compound Name | 1-(1-butan-2-ylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 79953419 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-(1-butan-2-ylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one |
| SMILES | CCC(C)n1ccc(CC(=O)CCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N2O/c1-3-9(2)17-7-5-10(16-17)8-11(18)4-6-12(13,14)15/h5,7,9H,3-4,6,8H2,1-2H3 |
| InChIKey | NKRCPJLPCAQCMO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |