C17H27N3S — CID 79953496
N-(5,5-dimethylthian-3-yl)-6-piperidin-1-ylpyridin-3-amine (PubChem CID 79953496) has the molecular formula C17H27N3S and a molecular weight of 305.49 g/mol. Its IUPAC name is N-(5,5-dimethylthian-3-yl)-6-piperidin-1-ylpyridin-3-amine.
| Compound Name | N-(5,5-dimethylthian-3-yl)-6-piperidin-1-ylpyridin-3-amine |
|---|---|
| PubChem CID | 79953496 |
| Molecular Formula | C17H27N3S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-(5,5-dimethylthian-3-yl)-6-piperidin-1-ylpyridin-3-amine |
| SMILES | CC1(C)CSCC(Nc2ccc(N3CCCCC3)nc2)C1 |
| InChI | InChI=1S/C17H27N3S/c1-17(2)10-15(12-21-13-17)19-14-6-7-16(18-11-14)20-8-4-3-5-9-20/h6-7,11,15,19H,3-5,8-10,12-13H2,1-2H3 |
| InChIKey | ROEZXHFFDNPZJF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |