C7H6F3IN2O — CID 79953718
5-iodo-2-(3,3,3-trifluoropropyl)-1H-pyrimidin-6-one (PubChem CID 79953718) has the molecular formula C7H6F3IN2O and a molecular weight of 318.04 g/mol. Its IUPAC name is 5-iodo-2-(3,3,3-trifluoropropyl)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-2-(3,3,3-trifluoropropyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79953718 |
| Molecular Formula | C7H6F3IN2O |
| Molecular Weight | 318.04 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | 5-iodo-2-(3,3,3-trifluoropropyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CCC(F)(F)F)ncc1I |
| InChI | InChI=1S/C7H6F3IN2O/c8-7(9,10)2-1-5-12-3-4(11)6(14)13-5/h3H,1-2H2,(H,12,13,14) |
| InChIKey | KPQGISMJQVGJHN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.04 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|