C16H16N2O4 — CID 7995387
[(1R)-2-oxocyclohexyl] 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 7995387) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | [(1R)-2-oxocyclohexyl] 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 7995387 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)O[C@@H]1CCCCC1=O |
| InChI | InChI=1S/C16H16N2O4/c19-13-7-3-4-8-14(13)22-15(20)9-18-10-17-12-6-2-1-5-11(12)16(18)21/h1-2,5-6,10,14H,3-4,7-9H2/t14-/m1/s1 |
| InChIKey | OQHBAILHYGKBLF-CQSZACIVSA-N |
| XLogP | 1.45 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |