About 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide
4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide (PubChem CID 79955054) has the molecular formula C16H24N2OS
and a molecular weight of 292.45 g/mol. Its IUPAC name is 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide.
Molecular Properties
| Compound Name | 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide |
| PubChem CID | 79955054 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CNC2CSCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H24N2OS/c1-16(2)8-14(10-20-11-16)18-9-12-4-6-13(7-5-12)15(19)17-3/h4-7,14,18H,8-11H2,1-3H3,(H,17,19) |
| InChIKey | KIMQFWGNCAMKDP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide?
The IUPAC name of 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide (CID 79955054) is 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide.
What is the SMILES notation for 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide?
The canonical SMILES for 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide is CNC(=O)c1ccc(CNC2CSCC(C)(C)C2)cc1.
What is the InChIKey of 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide?
The InChIKey is KIMQFWGNCAMKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2OS/c1-16(2)8-14(10-20-11-16)18-9-12-4-6-13(7-5-12)15(19)17-3/h4-7,14,18H,8-11H2,1-3H3,(H,17,19).
What are the key properties of 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide?
4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide has a molecular weight of 292.45 g/mol, XLogP of 2.67, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(5,5-dimethylthian-3-yl)amino]methyl]-N-methylbenzamide is sourced from PubChem (CID 79955054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).