C13H20N2S — CID 79955058
5,5-dimethyl-N-(pyridin-3-ylmethyl)thian-3-amine (PubChem CID 79955058) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 5,5-dimethyl-N-(pyridin-3-ylmethyl)thian-3-amine.
| Compound Name | 5,5-dimethyl-N-(pyridin-3-ylmethyl)thian-3-amine |
|---|---|
| PubChem CID | 79955058 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5,5-dimethyl-N-(pyridin-3-ylmethyl)thian-3-amine |
| SMILES | CC1(C)CSCC(NCc2cccnc2)C1 |
| InChI | InChI=1S/C13H20N2S/c1-13(2)6-12(9-16-10-13)15-8-11-4-3-5-14-7-11/h3-5,7,12,15H,6,8-10H2,1-2H3 |
| InChIKey | FHBAYQOXKASEMB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |