About 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile
4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile (PubChem CID 79955212) has the molecular formula C13H7BrN4O
and a molecular weight of 315.13 g/mol. Its IUPAC name is 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile.
Molecular Properties
| Compound Name | 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile |
| PubChem CID | 79955212 |
| Molecular Formula | C13H7BrN4O |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile |
| SMILES | N#Cc1ccc(Oc2nc(Br)cn3ccnc23)cc1 |
| InChI | InChI=1S/C13H7BrN4O/c14-11-8-18-6-5-16-12(18)13(17-11)19-10-3-1-9(7-15)2-4-10/h1-6,8H |
| InChIKey | ZMRJFVOWBIVHCD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile?
The IUPAC name of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile (CID 79955212) is 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile.
What is the SMILES notation for 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile?
The canonical SMILES for 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile is N#Cc1ccc(Oc2nc(Br)cn3ccnc23)cc1.
What is the InChIKey of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile?
The InChIKey is ZMRJFVOWBIVHCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrN4O/c14-11-8-18-6-5-16-12(18)13(17-11)19-10-3-1-9(7-15)2-4-10/h1-6,8H.
What are the key properties of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile?
4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile has a molecular weight of 315.13 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)oxybenzonitrile is sourced from PubChem (CID 79955212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).