About 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile
3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile (PubChem CID 79947007) has the molecular formula C14H10BrN5
and a molecular weight of 328.17 g/mol. Its IUPAC name is 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile.
Molecular Properties
| Compound Name | 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile |
| PubChem CID | 79947007 |
| Molecular Formula | C14H10BrN5 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile |
| SMILES | CN(c1cccc(C#N)c1)c1nc(Br)cn2ccnc12 |
| InChI | InChI=1S/C14H10BrN5/c1-19(11-4-2-3-10(7-11)8-16)14-13-17-5-6-20(13)9-12(15)18-14/h2-7,9H,1H3 |
| InChIKey | LUMXOHABWJFISZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile?
The IUPAC name of 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile (CID 79947007) is 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile.
What is the SMILES notation for 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile?
The canonical SMILES for 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile is CN(c1cccc(C#N)c1)c1nc(Br)cn2ccnc12.
What is the InChIKey of 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile?
The InChIKey is LUMXOHABWJFISZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrN5/c1-19(11-4-2-3-10(7-11)8-16)14-13-17-5-6-20(13)9-12(15)18-14/h2-7,9H,1H3.
What are the key properties of 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile?
3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile has a molecular weight of 328.17 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]benzonitrile is sourced from PubChem (CID 79947007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).