C10H13BrN4 — CID 79955501
6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 79955501) has the molecular formula C10H13BrN4 and a molecular weight of 269.15 g/mol. Its IUPAC name is 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 79955501 |
| Molecular Formula | C10H13BrN4 |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCN(CC)c1nc(Br)cn2ccnc12 |
| InChI | InChI=1S/C10H13BrN4/c1-3-14(4-2)10-9-12-5-6-15(9)7-8(11)13-10/h5-7H,3-4H2,1-2H3 |
| InChIKey | ASTGVJBNBACMEU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |