About 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine
6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 79955501) has the molecular formula C10H13BrN4
and a molecular weight of 269.15 g/mol. Its IUPAC name is 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 79955501 |
| Molecular Formula | C10H13BrN4 |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCN(CC)c1nc(Br)cn2ccnc12 |
| InChI | InChI=1S/C10H13BrN4/c1-3-14(4-2)10-9-12-5-6-15(9)7-8(11)13-10/h5-7H,3-4H2,1-2H3 |
| InChIKey | ASTGVJBNBACMEU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine (CID 79955501) is 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine is CCN(CC)c1nc(Br)cn2ccnc12.
What is the InChIKey of 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine?
The InChIKey is ASTGVJBNBACMEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN4/c1-3-14(4-2)10-9-12-5-6-15(9)7-8(11)13-10/h5-7H,3-4H2,1-2H3.
What are the key properties of 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine?
6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine has a molecular weight of 269.15 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N,N-diethylimidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 79955501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).