C15H21BrClNOS — CID 79955714
N-(3-bromo-5-chloro-2-ethoxyphenyl)-5,5-dimethylthian-3-amine (PubChem CID 79955714) has the molecular formula C15H21BrClNOS and a molecular weight of 378.76 g/mol. Its IUPAC name is N-(3-bromo-5-chloro-2-ethoxyphenyl)-5,5-dimethylthian-3-amine.
| Compound Name | N-(3-bromo-5-chloro-2-ethoxyphenyl)-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79955714 |
| Molecular Formula | C15H21BrClNOS |
| Molecular Weight | 378.76 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | N-(3-bromo-5-chloro-2-ethoxyphenyl)-5,5-dimethylthian-3-amine |
| SMILES | CCOc1c(Br)cc(Cl)cc1NC1CSCC(C)(C)C1 |
| InChI | InChI=1S/C15H21BrClNOS/c1-4-19-14-12(16)5-10(17)6-13(14)18-11-7-15(2,3)9-20-8-11/h5-6,11,18H,4,7-9H2,1-3H3 |
| InChIKey | NCZZCBJUZIIWMR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.76 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |