C14H27NOS — CID 79956348
[3-(cyclohexylamino)-4,4-dimethylthian-3-yl]methanol (PubChem CID 79956348) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is [3-(cyclohexylamino)-4,4-dimethylthian-3-yl]methanol.
| Compound Name | [3-(cyclohexylamino)-4,4-dimethylthian-3-yl]methanol |
|---|---|
| PubChem CID | 79956348 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | [3-(cyclohexylamino)-4,4-dimethylthian-3-yl]methanol |
| SMILES | CC1(C)CCSCC1(CO)NC1CCCCC1 |
| InChI | InChI=1S/C14H27NOS/c1-13(2)8-9-17-11-14(13,10-16)15-12-6-4-3-5-7-12/h12,15-16H,3-11H2,1-2H3 |
| InChIKey | NPKQPYODVYMQHH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |