C11H16BrNS2 — CID 79956952
N-[(5-bromothiophen-2-yl)methyl]-2-methylthian-3-amine (PubChem CID 79956952) has the molecular formula C11H16BrNS2 and a molecular weight of 306.29 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-methylthian-3-amine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-methylthian-3-amine |
|---|---|
| PubChem CID | 79956952 |
| Molecular Formula | C11H16BrNS2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-methylthian-3-amine |
| SMILES | CC1SCCCC1NCc1ccc(Br)s1 |
| InChI | InChI=1S/C11H16BrNS2/c1-8-10(3-2-6-14-8)13-7-9-4-5-11(12)15-9/h4-5,8,10,13H,2-3,6-7H2,1H3 |
| InChIKey | TUNLYYJYWKTDGQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |