C13H15FN2S — CID 79957768
2-fluoro-5-[(2-methylthian-3-yl)amino]benzonitrile (PubChem CID 79957768) has the molecular formula C13H15FN2S and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-fluoro-5-[(2-methylthian-3-yl)amino]benzonitrile.
| Compound Name | 2-fluoro-5-[(2-methylthian-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 79957768 |
| Molecular Formula | C13H15FN2S |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-fluoro-5-[(2-methylthian-3-yl)amino]benzonitrile |
| SMILES | CC1SCCCC1Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C13H15FN2S/c1-9-13(3-2-6-17-9)16-11-4-5-12(14)10(7-11)8-15/h4-5,7,9,13,16H,2-3,6H2,1H3 |
| InChIKey | BFGQKPHKBRXWJS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |