C14H19FN2OS — CID 79958123
3-(3-fluoroanilino)-5,5-dimethylthiane-3-carboxamide (PubChem CID 79958123) has the molecular formula C14H19FN2OS and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-(3-fluoroanilino)-5,5-dimethylthiane-3-carboxamide.
| Compound Name | 3-(3-fluoroanilino)-5,5-dimethylthiane-3-carboxamide |
|---|---|
| PubChem CID | 79958123 |
| Molecular Formula | C14H19FN2OS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-(3-fluoroanilino)-5,5-dimethylthiane-3-carboxamide |
| SMILES | CC1(C)CSCC(Nc2cccc(F)c2)(C(N)=O)C1 |
| InChI | InChI=1S/C14H19FN2OS/c1-13(2)7-14(12(16)18,9-19-8-13)17-11-5-3-4-10(15)6-11/h3-6,17H,7-9H2,1-2H3,(H2,16,18) |
| InChIKey | FULNKFABNKGAKW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |