C16H23NO2S — CID 79947429
methyl 5,5-dimethyl-3-(3-methylanilino)thiane-3-carboxylate (PubChem CID 79947429) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is methyl 5,5-dimethyl-3-(3-methylanilino)thiane-3-carboxylate.
| Compound Name | methyl 5,5-dimethyl-3-(3-methylanilino)thiane-3-carboxylate |
|---|---|
| PubChem CID | 79947429 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl 5,5-dimethyl-3-(3-methylanilino)thiane-3-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(C)c2)CSCC(C)(C)C1 |
| InChI | InChI=1S/C16H23NO2S/c1-12-6-5-7-13(8-12)17-16(14(18)19-4)9-15(2,3)10-20-11-16/h5-8,17H,9-11H2,1-4H3 |
| InChIKey | RMEBARGUHWLLBL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |