C14H25NS — CID 79958327
N-(2-bicyclo[2.2.1]heptanyl)-5,5-dimethylthian-3-amine (PubChem CID 79958327) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-5,5-dimethylthian-3-amine.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79958327 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-5,5-dimethylthian-3-amine |
| SMILES | CC1(C)CSCC(NC2CC3CCC2C3)C1 |
| InChI | InChI=1S/C14H25NS/c1-14(2)7-12(8-16-9-14)15-13-6-10-3-4-11(13)5-10/h10-13,15H,3-9H2,1-2H3 |
| InChIKey | RTRIZWWKSDFQOZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |