C18H34N2O2S — CID 107241721
tert-butyl N-[4-[(5,5-dimethylthian-3-yl)amino]cyclohexyl]carbamate (PubChem CID 107241721) has the molecular formula C18H34N2O2S and a molecular weight of 342.55 g/mol. Its IUPAC name is tert-butyl N-[4-[(5,5-dimethylthian-3-yl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(5,5-dimethylthian-3-yl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 107241721 |
| Molecular Formula | C18H34N2O2S |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | tert-butyl N-[4-[(5,5-dimethylthian-3-yl)amino]cyclohexyl]carbamate |
| SMILES | CC1(C)CSCC(NC2CCC(NC(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C18H34N2O2S/c1-17(2,3)22-16(21)20-14-8-6-13(7-9-14)19-15-10-18(4,5)12-23-11-15/h13-15,19H,6-12H2,1-5H3,(H,20,21) |
| InChIKey | ALFREXADJKWYSC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |