C12H24N2O2S — CID 107237157
tert-butyl N-[(5,5-dimethylthian-3-yl)amino]carbamate (PubChem CID 107237157) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is tert-butyl N-[(5,5-dimethylthian-3-yl)amino]carbamate.
| Compound Name | tert-butyl N-[(5,5-dimethylthian-3-yl)amino]carbamate |
|---|---|
| PubChem CID | 107237157 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | tert-butyl N-[(5,5-dimethylthian-3-yl)amino]carbamate |
| SMILES | CC1(C)CSCC(NNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H24N2O2S/c1-11(2,3)16-10(15)14-13-9-6-12(4,5)8-17-7-9/h9,13H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | XRQSDRFIJGFAEK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|