C11H19N3O — CID 79960318
5-amino-3-methyl-4-(3-methylcyclohexyl)-4H-imidazol-2-one (PubChem CID 79960318) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-amino-3-methyl-4-(3-methylcyclohexyl)-4H-imidazol-2-one.
| Compound Name | 5-amino-3-methyl-4-(3-methylcyclohexyl)-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79960318 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 5-amino-3-methyl-4-(3-methylcyclohexyl)-4H-imidazol-2-one |
| SMILES | CC1CCCC(C2C(N)=NC(=O)N2C)C1 |
| InChI | InChI=1S/C11H19N3O/c1-7-4-3-5-8(6-7)9-10(12)13-11(15)14(9)2/h7-9H,3-6H2,1-2H3,(H2,12,13,15) |
| InChIKey | IMCQMFSZIVVLHL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |