C13H14F3N3OS — CID 79960818
5-amino-3-propyl-4-[4-(trifluoromethylsulfanyl)phenyl]-4H-imidazol-2-one (PubChem CID 79960818) has the molecular formula C13H14F3N3OS and a molecular weight of 317.34 g/mol. Its IUPAC name is 5-amino-3-propyl-4-[4-(trifluoromethylsulfanyl)phenyl]-4H-imidazol-2-one.
| Compound Name | 5-amino-3-propyl-4-[4-(trifluoromethylsulfanyl)phenyl]-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79960818 |
| Molecular Formula | C13H14F3N3OS |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 5-amino-3-propyl-4-[4-(trifluoromethylsulfanyl)phenyl]-4H-imidazol-2-one |
| SMILES | CCCN1C(=O)N=C(N)C1c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3N3OS/c1-2-7-19-10(11(17)18-12(19)20)8-3-5-9(6-4-8)21-13(14,15)16/h3-6,10H,2,7H2,1H3,(H2,17,18,20) |
| InChIKey | ZXOZXSKCCMQIDA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |