C15H21F2N3OS — CID 75519218
3-[[4-(difluoromethylsulfanyl)phenyl]methylamino]-N-ethylpyrrolidine-1-carboxamide (PubChem CID 75519218) has the molecular formula C15H21F2N3OS and a molecular weight of 329.42 g/mol. Its IUPAC name is 3-[[4-(difluoromethylsulfanyl)phenyl]methylamino]-N-ethylpyrrolidine-1-carboxamide.
| Compound Name | 3-[[4-(difluoromethylsulfanyl)phenyl]methylamino]-N-ethylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 75519218 |
| Molecular Formula | C15H21F2N3OS |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-[[4-(difluoromethylsulfanyl)phenyl]methylamino]-N-ethylpyrrolidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC(NCc2ccc(SC(F)F)cc2)C1 |
| InChI | InChI=1S/C15H21F2N3OS/c1-2-18-15(21)20-8-7-12(10-20)19-9-11-3-5-13(6-4-11)22-14(16)17/h3-6,12,14,19H,2,7-10H2,1H3,(H,18,21) |
| InChIKey | DFQVXASPOKGRGO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |