C14H19F2N3OS — CID 75476343
4-[[4-(difluoromethylsulfanyl)phenyl]methylamino]piperidine-1-carboxamide (PubChem CID 75476343) has the molecular formula C14H19F2N3OS and a molecular weight of 315.39 g/mol. Its IUPAC name is 4-[[4-(difluoromethylsulfanyl)phenyl]methylamino]piperidine-1-carboxamide.
| Compound Name | 4-[[4-(difluoromethylsulfanyl)phenyl]methylamino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 75476343 |
| Molecular Formula | C14H19F2N3OS |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 4-[[4-(difluoromethylsulfanyl)phenyl]methylamino]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(NCc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C14H19F2N3OS/c15-13(16)21-12-3-1-10(2-4-12)9-18-11-5-7-19(8-6-11)14(17)20/h1-4,11,13,18H,5-9H2,(H2,17,20) |
| InChIKey | BADVRCAYOGKRHC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |