C11H12FN3O — CID 79961456
5-amino-3-ethyl-4-(2-fluorophenyl)-4H-imidazol-2-one (PubChem CID 79961456) has the molecular formula C11H12FN3O and a molecular weight of 221.23 g/mol. Its IUPAC name is 5-amino-3-ethyl-4-(2-fluorophenyl)-4H-imidazol-2-one.
| Compound Name | 5-amino-3-ethyl-4-(2-fluorophenyl)-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79961456 |
| Molecular Formula | C11H12FN3O |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5-amino-3-ethyl-4-(2-fluorophenyl)-4H-imidazol-2-one |
| SMILES | CCN1C(=O)N=C(N)C1c1ccccc1F |
| InChI | InChI=1S/C11H12FN3O/c1-2-15-9(10(13)14-11(15)16)7-5-3-4-6-8(7)12/h3-6,9H,2H2,1H3,(H2,13,14,16) |
| InChIKey | NMSMNTHZOBTKNJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |