C22H23F2NO4 — CID 7996423
[2-[[(1S)-1-(3,4-dimethylphenyl)ethyl]amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 7996423) has the molecular formula C22H23F2NO4 and a molecular weight of 403.43 g/mol. Its IUPAC name is [2-[[(1S)-1-(3,4-dimethylphenyl)ethyl]amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[[(1S)-1-(3,4-dimethylphenyl)ethyl]amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7996423 |
| Molecular Formula | C22H23F2NO4 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | [2-[[(1S)-1-(3,4-dimethylphenyl)ethyl]amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | Cc1ccc([C@H](C)NC(=O)COC(=O)/C=C/c2ccc(OC(F)F)cc2)cc1C |
| InChI | InChI=1S/C22H23F2NO4/c1-14-4-8-18(12-15(14)2)16(3)25-20(26)13-28-21(27)11-7-17-5-9-19(10-6-17)29-22(23)24/h4-12,16,22H,13H2,1-3H3,(H,25,26)/b11-7+/t16-/m0/s1 |
| InChIKey | CYUFQTYNQICJDH-BPLPYTOXSA-N |
| XLogP | 4.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|