C13H15BrF3NOS — CID 79964365
5-bromo-4-methyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide (PubChem CID 79964365) has the molecular formula C13H15BrF3NOS and a molecular weight of 370.23 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-4-methyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79964365 |
| Molecular Formula | C13H15BrF3NOS |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 5-bromo-4-methyl-N-[3-(trifluoromethyl)cyclohexyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCCC(C(F)(F)F)C2)sc1Br |
| InChI | InChI=1S/C13H15BrF3NOS/c1-7-5-10(20-11(7)14)12(19)18-9-4-2-3-8(6-9)13(15,16)17/h5,8-9H,2-4,6H2,1H3,(H,18,19) |
| InChIKey | YKCANLBKDTUMMM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |