C15H23BrN2OS — CID 79964467
(5-bromo-4-methylthiophen-2-yl)-[4-(diethylamino)piperidin-1-yl]methanone (PubChem CID 79964467) has the molecular formula C15H23BrN2OS and a molecular weight of 359.33 g/mol. Its IUPAC name is (5-bromo-4-methylthiophen-2-yl)-[4-(diethylamino)piperidin-1-yl]methanone.
| Compound Name | (5-bromo-4-methylthiophen-2-yl)-[4-(diethylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 79964467 |
| Molecular Formula | C15H23BrN2OS |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (5-bromo-4-methylthiophen-2-yl)-[4-(diethylamino)piperidin-1-yl]methanone |
| SMILES | CCN(CC)C1CCN(C(=O)c2cc(C)c(Br)s2)CC1 |
| InChI | InChI=1S/C15H23BrN2OS/c1-4-17(5-2)12-6-8-18(9-7-12)15(19)13-10-11(3)14(16)20-13/h10,12H,4-9H2,1-3H3 |
| InChIKey | CCIOPOJURCWUSK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |