C16H24BrNOS — CID 79987284
(5-bromo-4-methylthiophen-2-yl)-(4-tert-butylazepan-1-yl)methanone (PubChem CID 79987284) has the molecular formula C16H24BrNOS and a molecular weight of 358.35 g/mol. Its IUPAC name is (5-bromo-4-methylthiophen-2-yl)-(4-tert-butylazepan-1-yl)methanone.
| Compound Name | (5-bromo-4-methylthiophen-2-yl)-(4-tert-butylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 79987284 |
| Molecular Formula | C16H24BrNOS |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (5-bromo-4-methylthiophen-2-yl)-(4-tert-butylazepan-1-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCC(C(C)(C)C)CC2)sc1Br |
| InChI | InChI=1S/C16H24BrNOS/c1-11-10-13(20-14(11)17)15(19)18-8-5-6-12(7-9-18)16(2,3)4/h10,12H,5-9H2,1-4H3 |
| InChIKey | VWWVUCZKLANYMK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |