C11H10N2O2 — CID 7996638
N-(2-methylphenyl)-1,2-oxazole-5-carboxamide (PubChem CID 7996638) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is N-(2-methylphenyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2-methylphenyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 7996638 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | N-(2-methylphenyl)-1,2-oxazole-5-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1ccno1 |
| InChI | InChI=1S/C11H10N2O2/c1-8-4-2-3-5-9(8)13-11(14)10-6-7-12-15-10/h2-7H,1H3,(H,13,14) |
| InChIKey | RDNWMJKSLVIFAJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |