C13H25NS2 — CID 79966723
1-(1,4-dithian-2-yl)-3-methylidene-N-propylpentan-1-amine (PubChem CID 79966723) has the molecular formula C13H25NS2 and a molecular weight of 259.48 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-3-methylidene-N-propylpentan-1-amine.
| Compound Name | 1-(1,4-dithian-2-yl)-3-methylidene-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 79966723 |
| Molecular Formula | C13H25NS2 |
| Molecular Weight | 259.48 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-3-methylidene-N-propylpentan-1-amine |
| SMILES | C=C(CC)CC(NCCC)C1CSCCS1 |
| InChI | InChI=1S/C13H25NS2/c1-4-6-14-12(9-11(3)5-2)13-10-15-7-8-16-13/h12-14H,3-10H2,1-2H3 |
| InChIKey | BVHHQCNKTGXDOP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|