C15H19N3O2 — CID 79967038
4-amino-1-benzyl-9-oxa-1,3-diazaspiro[4.6]undec-3-en-2-one (PubChem CID 79967038) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-amino-1-benzyl-9-oxa-1,3-diazaspiro[4.6]undec-3-en-2-one.
| Compound Name | 4-amino-1-benzyl-9-oxa-1,3-diazaspiro[4.6]undec-3-en-2-one |
|---|---|
| PubChem CID | 79967038 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-amino-1-benzyl-9-oxa-1,3-diazaspiro[4.6]undec-3-en-2-one |
| SMILES | NC1=NC(=O)N(Cc2ccccc2)C12CCCOCC2 |
| InChI | InChI=1S/C15H19N3O2/c16-13-15(7-4-9-20-10-8-15)18(14(19)17-13)11-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11H2,(H2,16,17,19) |
| InChIKey | LRIKOYDOJFLMJZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |