C10H15N3O — CID 79967780
4-amino-1-prop-2-enyl-1,3-diazaspiro[4.4]non-3-en-2-one (PubChem CID 79967780) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-amino-1-prop-2-enyl-1,3-diazaspiro[4.4]non-3-en-2-one.
| Compound Name | 4-amino-1-prop-2-enyl-1,3-diazaspiro[4.4]non-3-en-2-one |
|---|---|
| PubChem CID | 79967780 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 4-amino-1-prop-2-enyl-1,3-diazaspiro[4.4]non-3-en-2-one |
| SMILES | C=CCN1C(=O)N=C(N)C12CCCC2 |
| InChI | InChI=1S/C10H15N3O/c1-2-7-13-9(14)12-8(11)10(13)5-3-4-6-10/h2H,1,3-7H2,(H2,11,12,14) |
| InChIKey | WRDQXWQSURRAFA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|