C13H23N3O — CID 79966947
4-amino-5-ethyl-5-(2-methylbutyl)-1-prop-2-enylimidazol-2-one (PubChem CID 79966947) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 4-amino-5-ethyl-5-(2-methylbutyl)-1-prop-2-enylimidazol-2-one.
| Compound Name | 4-amino-5-ethyl-5-(2-methylbutyl)-1-prop-2-enylimidazol-2-one |
|---|---|
| PubChem CID | 79966947 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 4-amino-5-ethyl-5-(2-methylbutyl)-1-prop-2-enylimidazol-2-one |
| SMILES | C=CCN1C(=O)N=C(N)C1(CC)CC(C)CC |
| InChI | InChI=1S/C13H23N3O/c1-5-8-16-12(17)15-11(14)13(16,7-3)9-10(4)6-2/h5,10H,1,6-9H2,2-4H3,(H2,14,15,17) |
| InChIKey | VMBRYMBOHYYFHR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|