C14H17N3O3 — CID 79967051
5-amino-4-(3,4-dimethoxyphenyl)-3-prop-2-enyl-4H-imidazol-2-one (PubChem CID 79967051) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-amino-4-(3,4-dimethoxyphenyl)-3-prop-2-enyl-4H-imidazol-2-one.
| Compound Name | 5-amino-4-(3,4-dimethoxyphenyl)-3-prop-2-enyl-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79967051 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 5-amino-4-(3,4-dimethoxyphenyl)-3-prop-2-enyl-4H-imidazol-2-one |
| SMILES | C=CCN1C(=O)N=C(N)C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H17N3O3/c1-4-7-17-12(13(15)16-14(17)18)9-5-6-10(19-2)11(8-9)20-3/h4-6,8,12H,1,7H2,2-3H3,(H2,15,16,18) |
| InChIKey | MEMYUDSVAHLGDA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|