C13H12ClN3O3 — CID 79967320
5-amino-4-(7-chloro-1,3-benzodioxol-5-yl)-3-prop-2-enyl-4H-imidazol-2-one (PubChem CID 79967320) has the molecular formula C13H12ClN3O3 and a molecular weight of 293.71 g/mol. Its IUPAC name is 5-amino-4-(7-chloro-1,3-benzodioxol-5-yl)-3-prop-2-enyl-4H-imidazol-2-one.
| Compound Name | 5-amino-4-(7-chloro-1,3-benzodioxol-5-yl)-3-prop-2-enyl-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79967320 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 5-amino-4-(7-chloro-1,3-benzodioxol-5-yl)-3-prop-2-enyl-4H-imidazol-2-one |
| SMILES | C=CCN1C(=O)N=C(N)C1c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C13H12ClN3O3/c1-2-3-17-10(12(15)16-13(17)18)7-4-8(14)11-9(5-7)19-6-20-11/h2,4-5,10H,1,3,6H2,(H2,15,16,18) |
| InChIKey | XOLVKWINSCFQGP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|