C12H12F3N3OS — CID 79967085
5-amino-3-ethyl-4-[4-(trifluoromethylsulfanyl)phenyl]-4H-imidazol-2-one (PubChem CID 79967085) has the molecular formula C12H12F3N3OS and a molecular weight of 303.31 g/mol. Its IUPAC name is 5-amino-3-ethyl-4-[4-(trifluoromethylsulfanyl)phenyl]-4H-imidazol-2-one.
| Compound Name | 5-amino-3-ethyl-4-[4-(trifluoromethylsulfanyl)phenyl]-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79967085 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 5-amino-3-ethyl-4-[4-(trifluoromethylsulfanyl)phenyl]-4H-imidazol-2-one |
| SMILES | CCN1C(=O)N=C(N)C1c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F3N3OS/c1-2-18-9(10(16)17-11(18)19)7-3-5-8(6-4-7)20-12(13,14)15/h3-6,9H,2H2,1H3,(H2,16,17,19) |
| InChIKey | OOTUORMFGPQPJK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |