About propyl acetate
propyl acetate (PubChem CID 7997) has the molecular formula C5H10O2
and a molecular weight of 102.13 g/mol. Its IUPAC name is propyl acetate.
Molecular Properties
| Compound Name | propyl acetate |
| PubChem CID | 7997 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | propyl acetate |
| SMILES | CCCOC(C)=O |
| InChI | InChI=1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3 |
| InChIKey | YKYONYBAUNKHLG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl acetate?
The IUPAC name of propyl acetate (CID 7997) is propyl acetate.
What is the SMILES notation for propyl acetate?
The canonical SMILES for propyl acetate is CCCOC(C)=O.
What is the InChIKey of propyl acetate?
The InChIKey is YKYONYBAUNKHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3.
What are the key properties of propyl acetate?
propyl acetate has a molecular weight of 102.13 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl acetate is sourced from PubChem (CID 7997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).