C21H22N6S — CID 7997091
N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 7997091) has the molecular formula C21H22N6S and a molecular weight of 390.52 g/mol. Its IUPAC name is N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 7997091 |
| Molecular Formula | C21H22N6S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[C@@H](c1ccc(-n2cncn2)cc1)N(C)c1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C21H22N6S/c1-14(15-7-9-16(10-8-15)27-13-22-11-25-27)26(2)20-19-17-5-3-4-6-18(17)28-21(19)24-12-23-20/h7-14H,3-6H2,1-2H3/t14-/m0/s1 |
| InChIKey | PNPZDMLEKXGHBS-AWEZNQCLSA-N |
| XLogP | 4.35 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |