C19H18N4S2 — CID 8006782
N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 8006782) has the molecular formula C19H18N4S2 and a molecular weight of 366.52 g/mol. Its IUPAC name is N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 8006782 |
| Molecular Formula | C19H18N4S2 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-N-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | C[C@@H](c1nc2ccccc2s1)N(C)c1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C19H18N4S2/c1-11(18-22-13-7-3-4-8-15(13)25-18)23(2)17-16-12-6-5-9-14(12)24-19(16)21-10-20-17/h3-4,7-8,10-11H,5-6,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | XUQBHIXSPYILOB-NSHDSACASA-N |
| XLogP | 4.99 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |